Isoallolithocholic acid
Isoallolithocholic acid is a stereoisomeric derivative of Lithocholic acid and belongs to secondary bile acids. As endogenous metabolites, Isoallolithocholic acid exhibits unique functions in immune regulation: By activating nuclear receptors (such as fanitol X receptor FXR or retinoic acid-related orphan receptor RORγt), it specifically promotes the differentiation and function of regulatory T cells (Tregs), enhances their immunosuppressive activity (such as the secretion of IL-10 and TGF-β), and thereby inhibits excessive inflammatory responses. Studies have shown that Isoallolithocholic acid can induce naive T cells to differentiate into Tregs by regulating intracellular signaling pathways (such as AKT/mTOR) or epigenetic modifications (such as histone acetylation) within T cells. It has potential therapeutic value in models of autoimmune diseases such as colitis and multiple sclerosis.
| Physical Appearance | A solid |
| Storage | Store at -20°C for 3 years. |
| M.Wt | 376.57 |
| Cas No. | 2276-93-9 |
| Formula | C24H40O3 |
| Synonyms | 3β-Hydroxy-5α-cholanic acid |
| Chemical Name | (R)-4-((3S,5S,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid |
| Canonical SMILES | C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](CC3)(C[C@@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H](CCC(O)=O)C)[H])[H] |
| Shipping Condition | Small Molecules with Blue Ice, Modified Nucleotides with Dry Ice. |
| General tips | We do not recommend long-term storage for the solution, please use it up soon. |
