Protease and Phosphatase Inhibitor Cocktail (EDTA plus, 100X in ddH2O)
This product is a protease and phosphatase inhibitor cocktail (EDTA plus, 100X in ddH2O) that can be used to protect proteins during the extraction or lysis of primary cells, mammalian cultured cells, animal tissues, plant tissues, yeast, or bacterial cells. Protease inhibitors target aminopeptidase, cysteine, and serine proteases, while phosphatase inhibitors target serine/threonine and protein tyrosine phosphatases. This product is a ready-to-use mixed stock solution containing a separate 0.5 M EDTA solution package that can be optionally added.
This product is a ready-to-use mixed stock solution containing a separate 0.5 M EDTA solution package that can be optionally added.
|
Tube |
Catalog No. |
Product Name |
Summary |
Targets |
CAS Number |
Smiles |
|
A (100X in ddH2O) |
A2570 |
Leupeptin |
Serine and cysteine protease inhibitors |
Proteases | Serine Protease |
103476-89-7 |
O=C([C@@H](NC(C)=O)CC(C)C)N[C@@H](CC(C)C)C(N[C@H](C=O)CCCNC(N)=N)=O.OS(O)(=O)=O |
|
A2574 |
Aprotinin |
Bovine trypsin inhibitors |
Proteases | Serine Protease |
9087-70-1 |
CC(O)=O.CC.CC.CCccC.[R]. [P]. [2H]. [L]. [E]. [P]. [P]. [Y]. [3H]. [G]. [KH]. [R]. [R]. [Y].F.[Y]. [*]. [L].F.[V]. [Y]. [G]. [G]. [R]. [KH]. [R]. N.N.F.[KH].S.[*]. [2H]. [R]. [G]. [G]. [*]. [KH]. [*]. [3H].C.[*].F.[P]. [*]. I.I.N.[Q]. [3H]. [M] |
|
|
A2576 |
E-64 |
Cysteine protease inhibitors |
Proteases | Cathepsin |
66701-25-5 |
CC(C)CC(C(=O)NCCCCN=C(N)N)NC(=O)C1C(O1)C(=O)O |
|
|
A8621 |
Bestatin hydrochloride |
Aminopeptidase inhibitors |
Proteases | Aminopeptidase |
65391-42-6 |
CC(C)CC(C(=O)O)NC(=O)C(C(CC1=CC=CC=C1)N)O.Cl |
|
|
A8524 |
Sodium Orthovanadate |
PTP inhibitors |
Phosphatase | Tyrosine Phosphatases |
13721-39-6 |
[O-] [V] (=O) ([O-]) [O-]. [Na+]. [Na+]. [Na+] |
|
|
B7846 |
sodium fluoride |
Acid phosphatase inhibitors |
Phosphatase | Serine and Threonine Phosphatases |
7681-49-4 |
[F-]. [Na+] |
|
|
C4347 |
β-glycerophosphate |
Reversible inhibitors of serine/threonine phosphatase |
Phosphatase | Serine and Threonine Phosphatases |
13408-09-8 |
[O-] P(OC(CO)CO)([O-])=O.[Na+]. [Na+]. O.O.O.O.O |
|
|
|
Sodium pyrophosphate |
Irreversible inhibitor of serine/threonine phosphatase |
Phosphatase | Serine and Threonine Phosphatases |
7722-88-5 |
[O-] P(=O)([O-])OP(=O)([O-])[O-]. [Na+]. [Na+]. [Na+]. [Na+] |
|
|
B (100X in ddH2O) |
|
EDTA, disodium salt, dihydrate |
Metalloproteinase inhibitors |
Proteases| Metalloproteinase |
6381-92-6 |
C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
|
Store at -20°C for 1 year. |
||||||






