Hydrocortisone butyrate
Hydrocortisone 17-butyrate (CAS No.: 13609-67-1) is a potent synthetic glucocorticoid receptor agonist extensively utilized in biomedical research due to its anti-inflammatory, antipruritic, and vasoconstrictive properties. As a non-fluorinated topical corticosteroid, it serves as a model compound for investigating inflammatory skin conditions such as psoriasis and eczema, effectively inhibiting granuloma formation in rat models. Its mechanism of action involves the modulation of glucocorticoid pathways, leading to decreased synthesis of pro-inflammatory cytokines and mediators. In vitro, its activity has been observed from nanomolar to micromolar concentrations depending on the cellular context, allowing researchers to elucidate its impact on cellular processes in dermatitis and other cutaneous inflammatory models. Commonly employed in both cell and animal models, hydrocortisone 17-butyrate provides valuable insights into the regulation of immune responses and epidermal physiology, facilitating the development of new strategies in drug discovery for anti-inflammatory agents. Researchers can tailor the concentrations and experimental conditions to align with specific study objectives, thereby advancing the understanding of glucocorticoid receptor-mediated effects.
| Storage | ﹣20°C |
| M.Wt | 432.55 |
| Cas No. | 13609-67-1 |
| Formula | C25H36O6 |
| Synonyms | Hydrocortisone 17-butyrate |
| Chemical Name | (8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl butyrate |
| Canonical SMILES | O(C(CCC)=O)[C@@]1(C(CO)=O)[C@]2(C)[C@@](CC1)([C@]3([C@]([C@@H](O)C2)([C@]4(C)C(CC3)=CC(=O)CC4)[H])[H])[H] |
| Shipping Condition | Small Molecules with Blue Ice, Modified Nucleotides with Dry Ice. |
| General tips | We do not recommend long-term storage for the solution, please use it up soon. |






