D-Tartaric acid
D-Tartaric acid (CAS No.: 147-71-7) is a chiral organic acid and non-natural stereoisomer widely utilized as a biochemical probe in studies of metabolic regulation and enzyme modulation. This compound is primarily associated with cytoplasmic processes and can participate in biochemical transformations leading to structurally related metabolites, making it relevant for investigating stereospecific pathways and metabolic flux. Experimental evidence indicates that D-tartaric acid can influence enzyme activity and signaling pathways, thereby serving as a useful tool for dissecting molecular mechanisms underlying cellular metabolism and disease-related processes, although specific molecular targets remain context-dependent. In analytical and bioengineering research, it has been employed in the development of polymer-based biosensing systems, where it enhances detection sensitivity for microbial targets such as Vibrio parahaemolyticus, supporting its application in pathogen-related studies. Additionally, its occurrence in certain fermentation-derived matrices has prompted investigation as a potential metabolic biomarker in controlled experimental settings. In vitro studies typically explore its biological effects across low micromolar to millimolar concentration ranges depending on assay design, while in vivo or model organism studies adjust dosing based on experimental objectives. Overall, D-tartaric acid represents a versatile small molecule for probing enzymatic function, metabolic pathways, and biosensor development in life sciences and drug discovery research.
| Physical Appearance | A solid |
| Storage | -20°C |
| M.Wt | 150.09 |
| Cas No. | 147-71-7 |
| Formula | C4H6O6 |
| Solubility | ≥11.67 mg/mL in DMSO; ≥14.43 mg/mL in EtOH; ≥22.85 mg/mL in H2O |
| Chemical Name | (2S,3S)-2,3-dihydroxysuccinic acid |
| Canonical SMILES | OC([C@@H](O)[C@H](O)C(O)=O)=O |
| Shipping Condition | Small Molecules with Blue Ice, Modified Nucleotides with Dry Ice. |
| General tips | We do not recommend long-term storage for the solution, please use it up soon. |







